C20H28N4O2 — CID 56717748
1-(1,3-benzodioxol-5-yl)-N-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propyl]piperidin-4-amine (PubChem CID 56717748) has the molecular formula C20H28N4O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-N-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propyl]piperidin-4-amine.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-N-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propyl]piperidin-4-amine |
|---|---|
| PubChem CID | 56717748 |
| Molecular Formula | C20H28N4O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-N-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propyl]piperidin-4-amine |
| SMILES | Cc1n[nH]c(C)c1CCCNC1CCN(c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C20H28N4O2/c1-14-18(15(2)23-22-14)4-3-9-21-16-7-10-24(11-8-16)17-5-6-19-20(12-17)26-13-25-19/h5-6,12,16,21H,3-4,7-11,13H2,1-2H3,(H,22,23) |
| InChIKey | RTKMMIMRFORVKR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 62.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|