C21H16N6OS2 — CID 56726703
(6Z)-6-[(2-cyclopropyl-6-phenylimidazo[2,1-b][1,3,4]thiadiazol-5-yl)methylidene]-5-imino-3-methyl-[1,3]thiazolo[3,2-a]pyrimidin-7-one (PubChem CID 56726703) has the molecular formula C21H16N6OS2 and a molecular weight of 432.53 g/mol. Its IUPAC name is (6Z)-6-[(2-cyclopropyl-6-phenylimidazo[2,1-b][1,3,4]thiadiazol-5-yl)methylidene]-5-imino-3-methyl-[1,3]thiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | (6Z)-6-[(2-cyclopropyl-6-phenylimidazo[2,1-b][1,3,4]thiadiazol-5-yl)methylidene]-5-imino-3-methyl-[1,3]thiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 56726703 |
| Molecular Formula | C21H16N6OS2 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | (6Z)-6-[(2-cyclopropyl-6-phenylimidazo[2,1-b][1,3,4]thiadiazol-5-yl)methylidene]-5-imino-3-methyl-[1,3]thiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C/c2c(-c3ccccc3)nc3sc(C4CC4)nn23)/C(=O)N=C2SC=C(C)N2/1 |
| InChI | InChI=1S/C21H16N6OS2/c1-11-10-29-20-24-18(28)14(17(22)26(11)20)9-15-16(12-5-3-2-4-6-12)23-21-27(15)25-19(30-21)13-7-8-13/h2-6,9-10,13,22H,7-8H2,1H3/b14-9-,22-17- |
| InChIKey | HCFNAPOOXVUEMP-SJKIZNOSSA-N |
| XLogP | 4.50 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|