C29H24N6OS2 — CID 56726700
(6Z)-6-[(2-cyclohexyl-6-phenylimidazo[2,1-b][1,3,4]thiadiazol-5-yl)methylidene]-5-imino-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-7-one (PubChem CID 56726700) has the molecular formula C29H24N6OS2 and a molecular weight of 536.69 g/mol. Its IUPAC name is (6Z)-6-[(2-cyclohexyl-6-phenylimidazo[2,1-b][1,3,4]thiadiazol-5-yl)methylidene]-5-imino-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | (6Z)-6-[(2-cyclohexyl-6-phenylimidazo[2,1-b][1,3,4]thiadiazol-5-yl)methylidene]-5-imino-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 56726700 |
| Molecular Formula | C29H24N6OS2 |
| Molecular Weight | 536.69 g/mol |
| Exact Mass | 536.15 |
| IUPAC Name | (6Z)-6-[(2-cyclohexyl-6-phenylimidazo[2,1-b][1,3,4]thiadiazol-5-yl)methylidene]-5-imino-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C\c2c(-c3ccccc3)nc3sc(C4CCCCC4)nn23)\C(=O)N=C2SC=C(c3ccccc3)N2\1 |
| InChI | InChI=1S/C29H24N6OS2/c30-25-21(26(36)32-28-34(25)23(17-37-28)18-10-4-1-5-11-18)16-22-24(19-12-6-2-7-13-19)31-29-35(22)33-27(38-29)20-14-8-3-9-15-20/h1-2,4-7,10-13,16-17,20,30H,3,8-9,14-15H2/b21-16-,30-25+ |
| InChIKey | LUTSSAGQZNZNIP-ZZYDCKSYSA-N |
| XLogP | 6.81 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.69 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|