C26H20Cl2N4O3S2 — CID 56727857
(6Z)-6-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-5-imino-2-(thiophen-2-ylmethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 56727857) has the molecular formula C26H20Cl2N4O3S2 and a molecular weight of 571.51 g/mol. Its IUPAC name is (6Z)-6-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-5-imino-2-(thiophen-2-ylmethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | (6Z)-6-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-5-imino-2-(thiophen-2-ylmethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 56727857 |
| Molecular Formula | C26H20Cl2N4O3S2 |
| Molecular Weight | 571.51 g/mol |
| Exact Mass | 570.04 |
| IUPAC Name | (6Z)-6-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-5-imino-2-(thiophen-2-ylmethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C/c2ccc(OCc3ccc(Cl)c(Cl)c3)c(OCC)c2)/C(=O)N=C2SC(Cc3cccs3)=NN2/1 |
| InChI | InChI=1S/C26H20Cl2N4O3S2/c1-2-34-22-12-15(6-8-21(22)35-14-16-5-7-19(27)20(28)11-16)10-18-24(29)32-26(30-25(18)33)37-23(31-32)13-17-4-3-9-36-17/h3-12,29H,2,13-14H2,1H3/b18-10-,29-24- |
| InChIKey | VJYXPLQCPGWXPO-OQXSEEASSA-N |
| XLogP | 6.89 |
| TPSA | 87.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.51 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|