C18H21N3O3S — CID 56731565
1,3,3,7-tetramethyl-2-oxo-N-(pyridin-3-ylmethyl)indole-5-sulfonamide (PubChem CID 56731565) has the molecular formula C18H21N3O3S and a molecular weight of 359.45 g/mol. Its IUPAC name is 1,3,3,7-tetramethyl-2-oxo-N-(pyridin-3-ylmethyl)indole-5-sulfonamide.
| Compound Name | 1,3,3,7-tetramethyl-2-oxo-N-(pyridin-3-ylmethyl)indole-5-sulfonamide |
|---|---|
| PubChem CID | 56731565 |
| Molecular Formula | C18H21N3O3S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 1,3,3,7-tetramethyl-2-oxo-N-(pyridin-3-ylmethyl)indole-5-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCc2cccnc2)cc2c1N(C)C(=O)C2(C)C |
| InChI | InChI=1S/C18H21N3O3S/c1-12-8-14(9-15-16(12)21(4)17(22)18(15,2)3)25(23,24)20-11-13-6-5-7-19-10-13/h5-10,20H,11H2,1-4H3 |
| InChIKey | YCGAHTHCPVSRRC-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |