C16H24N2O3S — CID 56731556
N-butyl-1,3,3,7-tetramethyl-2-oxoindole-5-sulfonamide (PubChem CID 56731556) has the molecular formula C16H24N2O3S and a molecular weight of 324.45 g/mol. Its IUPAC name is N-butyl-1,3,3,7-tetramethyl-2-oxoindole-5-sulfonamide.
| Compound Name | N-butyl-1,3,3,7-tetramethyl-2-oxoindole-5-sulfonamide |
|---|---|
| PubChem CID | 56731556 |
| Molecular Formula | C16H24N2O3S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | N-butyl-1,3,3,7-tetramethyl-2-oxoindole-5-sulfonamide |
| SMILES | CCCCNS(=O)(=O)c1cc(C)c2c(c1)C(C)(C)C(=O)N2C |
| InChI | InChI=1S/C16H24N2O3S/c1-6-7-8-17-22(20,21)12-9-11(2)14-13(10-12)16(3,4)15(19)18(14)5/h9-10,17H,6-8H2,1-5H3 |
| InChIKey | ZSQWPVWVUNMXMS-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|