C14H20N2O4S — CID 56731590
N-(2-methoxyethyl)-3,3,7-trimethyl-2-oxo-1H-indole-5-sulfonamide (PubChem CID 56731590) has the molecular formula C14H20N2O4S and a molecular weight of 312.39 g/mol. Its IUPAC name is N-(2-methoxyethyl)-3,3,7-trimethyl-2-oxo-1H-indole-5-sulfonamide.
| Compound Name | N-(2-methoxyethyl)-3,3,7-trimethyl-2-oxo-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 56731590 |
| Molecular Formula | C14H20N2O4S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | N-(2-methoxyethyl)-3,3,7-trimethyl-2-oxo-1H-indole-5-sulfonamide |
| SMILES | COCCNS(=O)(=O)c1cc(C)c2c(c1)C(C)(C)C(=O)N2 |
| InChI | InChI=1S/C14H20N2O4S/c1-9-7-10(21(18,19)15-5-6-20-4)8-11-12(9)16-13(17)14(11,2)3/h7-8,15H,5-6H2,1-4H3,(H,16,17) |
| InChIKey | NYGJIPAMVSLTDP-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|