C14H18N2O3S — CID 56731610
3,3,7-trimethyl-2-oxo-N-prop-2-enyl-1H-indole-5-sulfonamide (PubChem CID 56731610) has the molecular formula C14H18N2O3S and a molecular weight of 294.38 g/mol. Its IUPAC name is 3,3,7-trimethyl-2-oxo-N-prop-2-enyl-1H-indole-5-sulfonamide.
| Compound Name | 3,3,7-trimethyl-2-oxo-N-prop-2-enyl-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 56731610 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 3,3,7-trimethyl-2-oxo-N-prop-2-enyl-1H-indole-5-sulfonamide |
| SMILES | C=CCNS(=O)(=O)c1cc(C)c2c(c1)C(C)(C)C(=O)N2 |
| InChI | InChI=1S/C14H18N2O3S/c1-5-6-15-20(18,19)10-7-9(2)12-11(8-10)14(3,4)13(17)16-12/h5,7-8,15H,1,6H2,2-4H3,(H,16,17) |
| InChIKey | DHMBKLALAYLYCJ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|