C18H22N2O3S2 — CID 171133386
3,3,7-trimethyl-2-oxo-N-(3-thiophen-2-ylpropyl)-1H-indole-5-sulfonamide (PubChem CID 171133386) has the molecular formula C18H22N2O3S2 and a molecular weight of 378.52 g/mol. Its IUPAC name is 3,3,7-trimethyl-2-oxo-N-(3-thiophen-2-ylpropyl)-1H-indole-5-sulfonamide.
| Compound Name | 3,3,7-trimethyl-2-oxo-N-(3-thiophen-2-ylpropyl)-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 171133386 |
| Molecular Formula | C18H22N2O3S2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | 3,3,7-trimethyl-2-oxo-N-(3-thiophen-2-ylpropyl)-1H-indole-5-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCCCc2cccs2)cc2c1NC(=O)C2(C)C |
| InChI | InChI=1S/C18H22N2O3S2/c1-12-10-14(11-15-16(12)20-17(21)18(15,2)3)25(22,23)19-8-4-6-13-7-5-9-24-13/h5,7,9-11,19H,4,6,8H2,1-3H3,(H,20,21) |
| InChIKey | OBLLQXXVOJEGIX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|