C10H14ClN5S — CID 56736827
6-(chloromethyl)-3-(piperidin-1-ylmethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 56736827) has the molecular formula C10H14ClN5S and a molecular weight of 271.78 g/mol. Its IUPAC name is 6-(chloromethyl)-3-(piperidin-1-ylmethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 6-(chloromethyl)-3-(piperidin-1-ylmethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 56736827 |
| Molecular Formula | C10H14ClN5S |
| Molecular Weight | 271.78 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 6-(chloromethyl)-3-(piperidin-1-ylmethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | ClCc1nn2c(CN3CCCCC3)nnc2s1 |
| InChI | InChI=1S/C10H14ClN5S/c11-6-9-14-16-8(12-13-10(16)17-9)7-15-4-2-1-3-5-15/h1-7H2 |
| InChIKey | GYMBTZAWEXUDTQ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 46.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.78 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|