C17H17F3N4 — CID 56741267
2-ethyl-5-methyl-4-[1-[[3-(trifluoromethyl)phenyl]methyl]imidazol-2-yl]-1H-imidazole (PubChem CID 56741267) has the molecular formula C17H17F3N4 and a molecular weight of 334.35 g/mol. Its IUPAC name is 2-ethyl-5-methyl-4-[1-[[3-(trifluoromethyl)phenyl]methyl]imidazol-2-yl]-1H-imidazole.
| Compound Name | 2-ethyl-5-methyl-4-[1-[[3-(trifluoromethyl)phenyl]methyl]imidazol-2-yl]-1H-imidazole |
|---|---|
| PubChem CID | 56741267 |
| Molecular Formula | C17H17F3N4 |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 2-ethyl-5-methyl-4-[1-[[3-(trifluoromethyl)phenyl]methyl]imidazol-2-yl]-1H-imidazole |
| SMILES | CCc1nc(-c2nccn2Cc2cccc(C(F)(F)F)c2)c(C)[nH]1 |
| InChI | InChI=1S/C17H17F3N4/c1-3-14-22-11(2)15(23-14)16-21-7-8-24(16)10-12-5-4-6-13(9-12)17(18,19)20/h4-9H,3,10H2,1-2H3,(H,22,23) |
| InChIKey | LZJLSLMTQXKPRJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |