C17H15N3O5 — CID 56744854
[3-(2-methoxyphenoxy)azetidin-1-yl]-(1-oxido-2,1,3-benzoxadiazol-1-ium-5-yl)methanone (PubChem CID 56744854) has the molecular formula C17H15N3O5 and a molecular weight of 341.32 g/mol. Its IUPAC name is [3-(2-methoxyphenoxy)azetidin-1-yl]-(1-oxido-2,1,3-benzoxadiazol-1-ium-5-yl)methanone.
| Compound Name | [3-(2-methoxyphenoxy)azetidin-1-yl]-(1-oxido-2,1,3-benzoxadiazol-1-ium-5-yl)methanone |
|---|---|
| PubChem CID | 56744854 |
| Molecular Formula | C17H15N3O5 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | [3-(2-methoxyphenoxy)azetidin-1-yl]-(1-oxido-2,1,3-benzoxadiazol-1-ium-5-yl)methanone |
| SMILES | COc1ccccc1OC1CN(C(=O)c2ccc3c(c2)no[n+]3[O-])C1 |
| InChI | InChI=1S/C17H15N3O5/c1-23-15-4-2-3-5-16(15)24-12-9-19(10-12)17(21)11-6-7-14-13(8-11)18-25-20(14)22/h2-8,12H,9-10H2,1H3 |
| InChIKey | KVYOEEAKLGVLQN-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 91.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|