C16H23N3OS — CID 56745556
1-[[5-[1-(2-methoxyethyl)imidazol-2-yl]thiophen-3-yl]methyl]piperidine (PubChem CID 56745556) has the molecular formula C16H23N3OS and a molecular weight of 305.45 g/mol. Its IUPAC name is 1-[[5-[1-(2-methoxyethyl)imidazol-2-yl]thiophen-3-yl]methyl]piperidine.
| Compound Name | 1-[[5-[1-(2-methoxyethyl)imidazol-2-yl]thiophen-3-yl]methyl]piperidine |
|---|---|
| PubChem CID | 56745556 |
| Molecular Formula | C16H23N3OS |
| Molecular Weight | 305.45 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 1-[[5-[1-(2-methoxyethyl)imidazol-2-yl]thiophen-3-yl]methyl]piperidine |
| SMILES | COCCn1ccnc1-c1cc(CN2CCCCC2)cs1 |
| InChI | InChI=1S/C16H23N3OS/c1-20-10-9-19-8-5-17-16(19)15-11-14(13-21-15)12-18-6-3-2-4-7-18/h5,8,11,13H,2-4,6-7,9-10,12H2,1H3 |
| InChIKey | QLOFGKSGTMGQGQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.45 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |