C18H25N3OS — CID 56874022
1-(oxan-4-ylmethyl)-2-[4-(pyrrolidin-1-ylmethyl)thiophen-2-yl]imidazole (PubChem CID 56874022) has the molecular formula C18H25N3OS and a molecular weight of 331.48 g/mol. Its IUPAC name is 1-(oxan-4-ylmethyl)-2-[4-(pyrrolidin-1-ylmethyl)thiophen-2-yl]imidazole.
| Compound Name | 1-(oxan-4-ylmethyl)-2-[4-(pyrrolidin-1-ylmethyl)thiophen-2-yl]imidazole |
|---|---|
| PubChem CID | 56874022 |
| Molecular Formula | C18H25N3OS |
| Molecular Weight | 331.48 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 1-(oxan-4-ylmethyl)-2-[4-(pyrrolidin-1-ylmethyl)thiophen-2-yl]imidazole |
| SMILES | c1cn(CC2CCOCC2)c(-c2cc(CN3CCCC3)cs2)n1 |
| InChI | InChI=1S/C18H25N3OS/c1-2-7-20(6-1)12-16-11-17(23-14-16)18-19-5-8-21(18)13-15-3-9-22-10-4-15/h5,8,11,14-15H,1-4,6-7,9-10,12-13H2 |
| InChIKey | IKPPUCOUABLBPX-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.48 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |