C16H21N3O2S — CID 56866312
ethyl 4-[2-(3-methylthiophen-2-yl)imidazol-1-yl]piperidine-1-carboxylate (PubChem CID 56866312) has the molecular formula C16H21N3O2S and a molecular weight of 319.43 g/mol. Its IUPAC name is ethyl 4-[2-(3-methylthiophen-2-yl)imidazol-1-yl]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[2-(3-methylthiophen-2-yl)imidazol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 56866312 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | ethyl 4-[2-(3-methylthiophen-2-yl)imidazol-1-yl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(n2ccnc2-c2sccc2C)CC1 |
| InChI | InChI=1S/C16H21N3O2S/c1-3-21-16(20)18-8-4-13(5-9-18)19-10-7-17-15(19)14-12(2)6-11-22-14/h6-7,10-11,13H,3-5,8-9H2,1-2H3 |
| InChIKey | JIWOWTXBMZZLLO-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |