C18H20N6S — CID 56747345
N-[(5-ethyl-1,3,4-thiadiazol-2-yl)methyl]-2-phenyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-amine (PubChem CID 56747345) has the molecular formula C18H20N6S and a molecular weight of 352.47 g/mol. Its IUPAC name is N-[(5-ethyl-1,3,4-thiadiazol-2-yl)methyl]-2-phenyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-amine.
| Compound Name | N-[(5-ethyl-1,3,4-thiadiazol-2-yl)methyl]-2-phenyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 56747345 |
| Molecular Formula | C18H20N6S |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | N-[(5-ethyl-1,3,4-thiadiazol-2-yl)methyl]-2-phenyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-amine |
| SMILES | CCc1nnc(CNc2nc(-c3ccccc3)nc3c2CCNC3)s1 |
| InChI | InChI=1S/C18H20N6S/c1-2-15-23-24-16(25-15)11-20-18-13-8-9-19-10-14(13)21-17(22-18)12-6-4-3-5-7-12/h3-7,19H,2,8-11H2,1H3,(H,20,21,22) |
| InChIKey | VSSXGKFOEMJUSF-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |