C18H22FN3O — CID 56749379
[4-[(3-fluorophenyl)methyl]-1-(4-methylpyrimidin-2-yl)piperidin-4-yl]methanol (PubChem CID 56749379) has the molecular formula C18H22FN3O and a molecular weight of 315.39 g/mol. Its IUPAC name is [4-[(3-fluorophenyl)methyl]-1-(4-methylpyrimidin-2-yl)piperidin-4-yl]methanol.
| Compound Name | [4-[(3-fluorophenyl)methyl]-1-(4-methylpyrimidin-2-yl)piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 56749379 |
| Molecular Formula | C18H22FN3O |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | [4-[(3-fluorophenyl)methyl]-1-(4-methylpyrimidin-2-yl)piperidin-4-yl]methanol |
| SMILES | Cc1ccnc(N2CCC(CO)(Cc3cccc(F)c3)CC2)n1 |
| InChI | InChI=1S/C18H22FN3O/c1-14-5-8-20-17(21-14)22-9-6-18(13-23,7-10-22)12-15-3-2-4-16(19)11-15/h2-5,8,11,23H,6-7,9-10,12-13H2,1H3 |
| InChIKey | PCQOGGFQQCMYML-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |