C22H34N6O — CID 72792563
4-[[2-(butylamino)-5-[5-[(dimethylamino)methyl]-2-pyridinyl]pyrimidin-4-yl]amino]cyclohexan-1-ol (PubChem CID 72792563) has the molecular formula C22H34N6O and a molecular weight of 398.56 g/mol. Its IUPAC name is 4-[[2-(butylamino)-5-[5-[(dimethylamino)methyl]-2-pyridinyl]pyrimidin-4-yl]amino]cyclohexan-1-ol.
| Compound Name | 4-[[2-(butylamino)-5-[5-[(dimethylamino)methyl]-2-pyridinyl]pyrimidin-4-yl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 72792563 |
| Molecular Formula | C22H34N6O |
| Molecular Weight | 398.56 g/mol |
| Exact Mass | 398.28 |
| IUPAC Name | 4-[[2-(butylamino)-5-[5-[(dimethylamino)methyl]-2-pyridinyl]pyrimidin-4-yl]amino]cyclohexan-1-ol |
| SMILES | CCCCNc1ncc(-c2ccc(CN(C)C)cn2)c(NC2CCC(O)CC2)n1 |
| InChI | InChI=1S/C22H34N6O/c1-4-5-12-23-22-25-14-19(20-11-6-16(13-24-20)15-28(2)3)21(27-22)26-17-7-9-18(29)10-8-17/h6,11,13-14,17-18,29H,4-5,7-10,12,15H2,1-3H3,(H2,23,25,26,27) |
| InChIKey | WQLWLOMHWYQNFN-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 86.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.56 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|