C16H26N4O3 — CID 56749581
N-cyclohexyl-2-oxo-2-(5-oxo-1,4,9-triazaspiro[5.5]undecan-9-yl)acetamide (PubChem CID 56749581) has the molecular formula C16H26N4O3 and a molecular weight of 322.41 g/mol. Its IUPAC name is N-cyclohexyl-2-oxo-2-(5-oxo-1,4,9-triazaspiro[5.5]undecan-9-yl)acetamide.
| Compound Name | N-cyclohexyl-2-oxo-2-(5-oxo-1,4,9-triazaspiro[5.5]undecan-9-yl)acetamide |
|---|---|
| PubChem CID | 56749581 |
| Molecular Formula | C16H26N4O3 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | N-cyclohexyl-2-oxo-2-(5-oxo-1,4,9-triazaspiro[5.5]undecan-9-yl)acetamide |
| SMILES | O=C(NC1CCCCC1)C(=O)N1CCC2(CC1)NCCNC2=O |
| InChI | InChI=1S/C16H26N4O3/c21-13(19-12-4-2-1-3-5-12)14(22)20-10-6-16(7-11-20)15(23)17-8-9-18-16/h12,18H,1-11H2,(H,17,23)(H,19,21) |
| InChIKey | YKKYCXQRWRXPPL-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|