C19H20FN7O — CID 56752652
1-(3-fluorophenyl)-3-[2-(1-pyrimidin-2-ylpiperidin-4-yl)pyrazol-3-yl]urea (PubChem CID 56752652) has the molecular formula C19H20FN7O and a molecular weight of 381.42 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-3-[2-(1-pyrimidin-2-ylpiperidin-4-yl)pyrazol-3-yl]urea.
| Compound Name | 1-(3-fluorophenyl)-3-[2-(1-pyrimidin-2-ylpiperidin-4-yl)pyrazol-3-yl]urea |
|---|---|
| PubChem CID | 56752652 |
| Molecular Formula | C19H20FN7O |
| Molecular Weight | 381.42 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 1-(3-fluorophenyl)-3-[2-(1-pyrimidin-2-ylpiperidin-4-yl)pyrazol-3-yl]urea |
| SMILES | O=C(Nc1cccc(F)c1)Nc1ccnn1C1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C19H20FN7O/c20-14-3-1-4-15(13-14)24-19(28)25-17-5-10-23-27(17)16-6-11-26(12-7-16)18-21-8-2-9-22-18/h1-5,8-10,13,16H,6-7,11-12H2,(H2,24,25,28) |
| InChIKey | KONCISBWJZXVEW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |