C18H23FN6O2 — CID 56753158
1-[2-[1-[(2S)-2-aminopropanoyl]piperidin-4-yl]pyrazol-3-yl]-3-(3-fluorophenyl)urea (PubChem CID 56753158) has the molecular formula C18H23FN6O2 and a molecular weight of 374.42 g/mol. Its IUPAC name is 1-[2-[1-[(2S)-2-aminopropanoyl]piperidin-4-yl]pyrazol-3-yl]-3-(3-fluorophenyl)urea.
| Compound Name | 1-[2-[1-[(2S)-2-aminopropanoyl]piperidin-4-yl]pyrazol-3-yl]-3-(3-fluorophenyl)urea |
|---|---|
| PubChem CID | 56753158 |
| Molecular Formula | C18H23FN6O2 |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 1-[2-[1-[(2S)-2-aminopropanoyl]piperidin-4-yl]pyrazol-3-yl]-3-(3-fluorophenyl)urea |
| SMILES | C[C@H](N)C(=O)N1CCC(n2nccc2NC(=O)Nc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C18H23FN6O2/c1-12(20)17(26)24-9-6-15(7-10-24)25-16(5-8-21-25)23-18(27)22-14-4-2-3-13(19)11-14/h2-5,8,11-12,15H,6-7,9-10,20H2,1H3,(H2,22,23,27)/t12-/m0/s1 |
| InChIKey | PNGLJVNSHUVFRG-LBPRGKRZSA-N |
| XLogP | 2.18 |
| TPSA | 105.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |