C18H22N4O — CID 56753950
3-(benzotriazol-1-yl)-1-[(2R,6R)-6-methyl-2-prop-2-enyl-3,6-dihydro-2H-pyridin-1-yl]propan-1-one (PubChem CID 56753950) has the molecular formula C18H22N4O and a molecular weight of 310.40 g/mol. Its IUPAC name is 3-(benzotriazol-1-yl)-1-[(2R,6R)-6-methyl-2-prop-2-enyl-3,6-dihydro-2H-pyridin-1-yl]propan-1-one.
| Compound Name | 3-(benzotriazol-1-yl)-1-[(2R,6R)-6-methyl-2-prop-2-enyl-3,6-dihydro-2H-pyridin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 56753950 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 3-(benzotriazol-1-yl)-1-[(2R,6R)-6-methyl-2-prop-2-enyl-3,6-dihydro-2H-pyridin-1-yl]propan-1-one |
| SMILES | C=CC[C@@H]1CC=C[C@@H](C)N1C(=O)CCn1nnc2ccccc21 |
| InChI | InChI=1S/C18H22N4O/c1-3-7-15-9-6-8-14(2)22(15)18(23)12-13-21-17-11-5-4-10-16(17)19-20-21/h3-6,8,10-11,14-15H,1,7,9,12-13H2,2H3/t14-,15-/m1/s1 |
| InChIKey | GQQYNGWJSLHFOM-HUUCEWRRSA-N |
| XLogP | 2.94 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|