C15H18N4O4 — CID 56756097
5-[(3-methoxyphenoxy)methyl]-N-[2-(methylamino)-2-oxoethyl]-1H-pyrazole-3-carboxamide (PubChem CID 56756097) has the molecular formula C15H18N4O4 and a molecular weight of 318.33 g/mol. Its IUPAC name is 5-[(3-methoxyphenoxy)methyl]-N-[2-(methylamino)-2-oxoethyl]-1H-pyrazole-3-carboxamide.
| Compound Name | 5-[(3-methoxyphenoxy)methyl]-N-[2-(methylamino)-2-oxoethyl]-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 56756097 |
| Molecular Formula | C15H18N4O4 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | 5-[(3-methoxyphenoxy)methyl]-N-[2-(methylamino)-2-oxoethyl]-1H-pyrazole-3-carboxamide |
| SMILES | CNC(=O)CNC(=O)c1cc(COc2cccc(OC)c2)[nH]n1 |
| InChI | InChI=1S/C15H18N4O4/c1-16-14(20)8-17-15(21)13-6-10(18-19-13)9-23-12-5-3-4-11(7-12)22-2/h3-7H,8-9H2,1-2H3,(H,16,20)(H,17,21)(H,18,19) |
| InChIKey | MZWZKFWTRSORTE-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 105.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |