C20H32N4O2 — CID 56756423
(4-cyclohexyl-1,4-diazepan-1-yl)-[6-(3-hydroxypropylamino)-3-pyridinyl]methanone (PubChem CID 56756423) has the molecular formula C20H32N4O2 and a molecular weight of 360.50 g/mol. Its IUPAC name is (4-cyclohexyl-1,4-diazepan-1-yl)-[6-(3-hydroxypropylamino)-3-pyridinyl]methanone.
| Compound Name | (4-cyclohexyl-1,4-diazepan-1-yl)-[6-(3-hydroxypropylamino)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 56756423 |
| Molecular Formula | C20H32N4O2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | (4-cyclohexyl-1,4-diazepan-1-yl)-[6-(3-hydroxypropylamino)-3-pyridinyl]methanone |
| SMILES | O=C(c1ccc(NCCCO)nc1)N1CCCN(C2CCCCC2)CC1 |
| InChI | InChI=1S/C20H32N4O2/c25-15-4-10-21-19-9-8-17(16-22-19)20(26)24-12-5-11-23(13-14-24)18-6-2-1-3-7-18/h8-9,16,18,25H,1-7,10-15H2,(H,21,22) |
| InChIKey | VWDSSIAATJUJML-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|