C19H18FN7 — CID 56757235
6-[3-[4-(4-fluorophenyl)-1H-pyrazol-5-yl]piperidin-1-yl]-7H-purine (PubChem CID 56757235) has the molecular formula C19H18FN7 and a molecular weight of 363.40 g/mol. Its IUPAC name is 6-[3-[4-(4-fluorophenyl)-1H-pyrazol-5-yl]piperidin-1-yl]-7H-purine.
| Compound Name | 6-[3-[4-(4-fluorophenyl)-1H-pyrazol-5-yl]piperidin-1-yl]-7H-purine |
|---|---|
| PubChem CID | 56757235 |
| Molecular Formula | C19H18FN7 |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 6-[3-[4-(4-fluorophenyl)-1H-pyrazol-5-yl]piperidin-1-yl]-7H-purine |
| SMILES | Fc1ccc(-c2cn[nH]c2C2CCCN(c3ncnc4nc[nH]c34)C2)cc1 |
| InChI | InChI=1S/C19H18FN7/c20-14-5-3-12(4-6-14)15-8-25-26-16(15)13-2-1-7-27(9-13)19-17-18(22-10-21-17)23-11-24-19/h3-6,8,10-11,13H,1-2,7,9H2,(H,25,26)(H,21,22,23,24) |
| InChIKey | HBOXNVMPSNMHAD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 86.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |