C17H19N3OS — CID 56762560
N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-2-(2-pyrrol-1-yl-1,3-thiazol-4-yl)acetamide (PubChem CID 56762560) has the molecular formula C17H19N3OS and a molecular weight of 313.43 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-2-(2-pyrrol-1-yl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-2-(2-pyrrol-1-yl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 56762560 |
| Molecular Formula | C17H19N3OS |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-2-(2-pyrrol-1-yl-1,3-thiazol-4-yl)acetamide |
| SMILES | O=C(Cc1csc(-n2cccc2)n1)NCC1CC2C=CC1C2 |
| InChI | InChI=1S/C17H19N3OS/c21-16(18-10-14-8-12-3-4-13(14)7-12)9-15-11-22-17(19-15)20-5-1-2-6-20/h1-6,11-14H,7-10H2,(H,18,21) |
| InChIKey | SLZSPEXMJKZIEH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|