C12H18N4O4S — CID 56764428
5-methyl-3-[2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl]pyrimidin-4-one (PubChem CID 56764428) has the molecular formula C12H18N4O4S and a molecular weight of 314.37 g/mol. Its IUPAC name is 5-methyl-3-[2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl]pyrimidin-4-one.
| Compound Name | 5-methyl-3-[2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 56764428 |
| Molecular Formula | C12H18N4O4S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 5-methyl-3-[2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl]pyrimidin-4-one |
| SMILES | Cc1cncn(CC(=O)N2CCN(S(C)(=O)=O)CC2)c1=O |
| InChI | InChI=1S/C12H18N4O4S/c1-10-7-13-9-15(12(10)18)8-11(17)14-3-5-16(6-4-14)21(2,19)20/h7,9H,3-6,8H2,1-2H3 |
| InChIKey | FILHGVNQTMPLLA-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 92.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |