C17H21FN4 — CID 56768393
2-(4-fluorophenyl)-6-methyl-N-(piperidin-3-ylmethyl)pyrimidin-4-amine (PubChem CID 56768393) has the molecular formula C17H21FN4 and a molecular weight of 300.38 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-6-methyl-N-(piperidin-3-ylmethyl)pyrimidin-4-amine.
| Compound Name | 2-(4-fluorophenyl)-6-methyl-N-(piperidin-3-ylmethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 56768393 |
| Molecular Formula | C17H21FN4 |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 2-(4-fluorophenyl)-6-methyl-N-(piperidin-3-ylmethyl)pyrimidin-4-amine |
| SMILES | Cc1cc(NCC2CCCNC2)nc(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C17H21FN4/c1-12-9-16(20-11-13-3-2-8-19-10-13)22-17(21-12)14-4-6-15(18)7-5-14/h4-7,9,13,19H,2-3,8,10-11H2,1H3,(H,20,21,22) |
| InChIKey | FIXAQGTYCVUMSC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |