C16H22N6 — CID 56780826
2-[[methyl-[(1-pyridazin-3-ylpyrrolidin-2-yl)methyl]amino]methyl]pentanedinitrile (PubChem CID 56780826) has the molecular formula C16H22N6 and a molecular weight of 298.39 g/mol. Its IUPAC name is 2-[[methyl-[(1-pyridazin-3-ylpyrrolidin-2-yl)methyl]amino]methyl]pentanedinitrile.
| Compound Name | 2-[[methyl-[(1-pyridazin-3-ylpyrrolidin-2-yl)methyl]amino]methyl]pentanedinitrile |
|---|---|
| PubChem CID | 56780826 |
| Molecular Formula | C16H22N6 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 2-[[methyl-[(1-pyridazin-3-ylpyrrolidin-2-yl)methyl]amino]methyl]pentanedinitrile |
| SMILES | CN(CC(C#N)CCC#N)CC1CCCN1c1cccnn1 |
| InChI | InChI=1S/C16H22N6/c1-21(12-14(11-18)5-2-8-17)13-15-6-4-10-22(15)16-7-3-9-19-20-16/h3,7,9,14-15H,2,4-6,10,12-13H2,1H3 |
| InChIKey | UUJZQEKVODXYSN-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 79.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |