C14H16N4OS — CID 56780984
N-[[2-(furan-2-yl)-1,3-thiazol-4-yl]methyl]-2-(4-methylpyrazol-1-yl)ethanamine (PubChem CID 56780984) has the molecular formula C14H16N4OS and a molecular weight of 288.38 g/mol. Its IUPAC name is N-[[2-(furan-2-yl)-1,3-thiazol-4-yl]methyl]-2-(4-methylpyrazol-1-yl)ethanamine.
| Compound Name | N-[[2-(furan-2-yl)-1,3-thiazol-4-yl]methyl]-2-(4-methylpyrazol-1-yl)ethanamine |
|---|---|
| PubChem CID | 56780984 |
| Molecular Formula | C14H16N4OS |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | N-[[2-(furan-2-yl)-1,3-thiazol-4-yl]methyl]-2-(4-methylpyrazol-1-yl)ethanamine |
| SMILES | Cc1cnn(CCNCc2csc(-c3ccco3)n2)c1 |
| InChI | InChI=1S/C14H16N4OS/c1-11-7-16-18(9-11)5-4-15-8-12-10-20-14(17-12)13-3-2-6-19-13/h2-3,6-7,9-10,15H,4-5,8H2,1H3 |
| InChIKey | JXHYXALLKACWRG-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 55.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|