C13H15N5O2 — CID 56780229
N-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]-2-(4-methylpyrazol-1-yl)ethanamine (PubChem CID 56780229) has the molecular formula C13H15N5O2 and a molecular weight of 273.30 g/mol. Its IUPAC name is N-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]-2-(4-methylpyrazol-1-yl)ethanamine.
| Compound Name | N-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]-2-(4-methylpyrazol-1-yl)ethanamine |
|---|---|
| PubChem CID | 56780229 |
| Molecular Formula | C13H15N5O2 |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | N-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]-2-(4-methylpyrazol-1-yl)ethanamine |
| SMILES | Cc1cnn(CCNCc2nc(-c3ccco3)no2)c1 |
| InChI | InChI=1S/C13H15N5O2/c1-10-7-15-18(9-10)5-4-14-8-12-16-13(17-20-12)11-3-2-6-19-11/h2-3,6-7,9,14H,4-5,8H2,1H3 |
| InChIKey | WUMBTVQBVORCRZ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|