C17H21NO3S — CID 56781571
N-[1-(1-benzothiophen-3-yl)ethyl]-2-(oxolan-2-ylmethoxy)acetamide (PubChem CID 56781571) has the molecular formula C17H21NO3S and a molecular weight of 319.43 g/mol. Its IUPAC name is N-[1-(1-benzothiophen-3-yl)ethyl]-2-(oxolan-2-ylmethoxy)acetamide.
| Compound Name | N-[1-(1-benzothiophen-3-yl)ethyl]-2-(oxolan-2-ylmethoxy)acetamide |
|---|---|
| PubChem CID | 56781571 |
| Molecular Formula | C17H21NO3S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | N-[1-(1-benzothiophen-3-yl)ethyl]-2-(oxolan-2-ylmethoxy)acetamide |
| SMILES | CC(NC(=O)COCC1CCCO1)c1csc2ccccc12 |
| InChI | InChI=1S/C17H21NO3S/c1-12(15-11-22-16-7-3-2-6-14(15)16)18-17(19)10-20-9-13-5-4-8-21-13/h2-3,6-7,11-13H,4-5,8-10H2,1H3,(H,18,19) |
| InChIKey | YPFBMPHGIIAWET-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |