C15H15ClN4O2 — CID 56783038
2-(4-chlorophenyl)-N-[2-oxo-2-(1H-pyrazol-4-ylamino)ethyl]cyclopropane-1-carboxamide (PubChem CID 56783038) has the molecular formula C15H15ClN4O2 and a molecular weight of 318.76 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[2-oxo-2-(1H-pyrazol-4-ylamino)ethyl]cyclopropane-1-carboxamide.
| Compound Name | 2-(4-chlorophenyl)-N-[2-oxo-2-(1H-pyrazol-4-ylamino)ethyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 56783038 |
| Molecular Formula | C15H15ClN4O2 |
| Molecular Weight | 318.76 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[2-oxo-2-(1H-pyrazol-4-ylamino)ethyl]cyclopropane-1-carboxamide |
| SMILES | O=C(CNC(=O)C1CC1c1ccc(Cl)cc1)Nc1cn[nH]c1 |
| InChI | InChI=1S/C15H15ClN4O2/c16-10-3-1-9(2-4-10)12-5-13(12)15(22)17-8-14(21)20-11-6-18-19-7-11/h1-4,6-7,12-13H,5,8H2,(H,17,22)(H,18,19)(H,20,21) |
| InChIKey | OEGHRDFXEBYCJQ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.76 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |