C15H12ClN5O2 — CID 71859391
7-chloro-N-[2-oxo-2-(1H-pyrazol-4-ylamino)ethyl]quinoline-2-carboxamide (PubChem CID 71859391) has the molecular formula C15H12ClN5O2 and a molecular weight of 329.75 g/mol. Its IUPAC name is 7-chloro-N-[2-oxo-2-(1H-pyrazol-4-ylamino)ethyl]quinoline-2-carboxamide.
| Compound Name | 7-chloro-N-[2-oxo-2-(1H-pyrazol-4-ylamino)ethyl]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 71859391 |
| Molecular Formula | C15H12ClN5O2 |
| Molecular Weight | 329.75 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 7-chloro-N-[2-oxo-2-(1H-pyrazol-4-ylamino)ethyl]quinoline-2-carboxamide |
| SMILES | O=C(CNC(=O)c1ccc2ccc(Cl)cc2n1)Nc1cn[nH]c1 |
| InChI | InChI=1S/C15H12ClN5O2/c16-10-3-1-9-2-4-12(21-13(9)5-10)15(23)17-8-14(22)20-11-6-18-19-7-11/h1-7H,8H2,(H,17,23)(H,18,19)(H,20,22) |
| InChIKey | LQYSBYDLIBPEPI-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.75 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |