C12H12ClN3OS — CID 43430717
3-(4-chlorophenyl)sulfanyl-N-(1H-pyrazol-4-yl)propanamide (PubChem CID 43430717) has the molecular formula C12H12ClN3OS and a molecular weight of 281.77 g/mol. Its IUPAC name is 3-(4-chlorophenyl)sulfanyl-N-(1H-pyrazol-4-yl)propanamide.
| Compound Name | 3-(4-chlorophenyl)sulfanyl-N-(1H-pyrazol-4-yl)propanamide |
|---|---|
| PubChem CID | 43430717 |
| Molecular Formula | C12H12ClN3OS |
| Molecular Weight | 281.77 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 3-(4-chlorophenyl)sulfanyl-N-(1H-pyrazol-4-yl)propanamide |
| SMILES | O=C(CCSc1ccc(Cl)cc1)Nc1cn[nH]c1 |
| InChI | InChI=1S/C12H12ClN3OS/c13-9-1-3-11(4-2-9)18-6-5-12(17)16-10-7-14-15-8-10/h1-4,7-8H,5-6H2,(H,14,15)(H,16,17) |
| InChIKey | YNKXAUCDZWSXCY-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.77 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |