C20H18ClN3O2S — CID 60549417
4-(4-chlorophenyl)sulfanyl-N-(4-pyrimidin-2-yloxyphenyl)butanamide (PubChem CID 60549417) has the molecular formula C20H18ClN3O2S and a molecular weight of 399.90 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfanyl-N-(4-pyrimidin-2-yloxyphenyl)butanamide.
| Compound Name | 4-(4-chlorophenyl)sulfanyl-N-(4-pyrimidin-2-yloxyphenyl)butanamide |
|---|---|
| PubChem CID | 60549417 |
| Molecular Formula | C20H18ClN3O2S |
| Molecular Weight | 399.90 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | 4-(4-chlorophenyl)sulfanyl-N-(4-pyrimidin-2-yloxyphenyl)butanamide |
| SMILES | O=C(CCCSc1ccc(Cl)cc1)Nc1ccc(Oc2ncccn2)cc1 |
| InChI | InChI=1S/C20H18ClN3O2S/c21-15-4-10-18(11-5-15)27-14-1-3-19(25)24-16-6-8-17(9-7-16)26-20-22-12-2-13-23-20/h2,4-13H,1,3,14H2,(H,24,25) |
| InChIKey | GRGSIKOWANOXRO-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.90 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|