C14H13F6NO2 — CID 56791910
(E)-1-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]-3-(5-methylfuran-2-yl)prop-2-en-1-one (PubChem CID 56791910) has the molecular formula C14H13F6NO2 and a molecular weight of 341.25 g/mol. Its IUPAC name is (E)-1-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]-3-(5-methylfuran-2-yl)prop-2-en-1-one.
| Compound Name | (E)-1-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]-3-(5-methylfuran-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 56791910 |
| Molecular Formula | C14H13F6NO2 |
| Molecular Weight | 341.25 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | (E)-1-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]-3-(5-methylfuran-2-yl)prop-2-en-1-one |
| SMILES | Cc1ccc(/C=C/C(=O)N2CCC(C(F)(F)F)(C(F)(F)F)C2)o1 |
| InChI | InChI=1S/C14H13F6NO2/c1-9-2-3-10(23-9)4-5-11(22)21-7-6-12(8-21,13(15,16)17)14(18,19)20/h2-5H,6-8H2,1H3/b5-4+ |
| InChIKey | UVRRYOHYJWOLKR-SNAWJCMRSA-N |
| XLogP | 3.94 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.25 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|