C15H21N3O4 — CID 56792823
methyl 3-[[4-[2-(dimethylamino)-2-oxoethyl]phenyl]carbamoylamino]propanoate (PubChem CID 56792823) has the molecular formula C15H21N3O4 and a molecular weight of 307.35 g/mol. Its IUPAC name is methyl 3-[[4-[2-(dimethylamino)-2-oxoethyl]phenyl]carbamoylamino]propanoate.
| Compound Name | methyl 3-[[4-[2-(dimethylamino)-2-oxoethyl]phenyl]carbamoylamino]propanoate |
|---|---|
| PubChem CID | 56792823 |
| Molecular Formula | C15H21N3O4 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | methyl 3-[[4-[2-(dimethylamino)-2-oxoethyl]phenyl]carbamoylamino]propanoate |
| SMILES | COC(=O)CCNC(=O)Nc1ccc(CC(=O)N(C)C)cc1 |
| InChI | InChI=1S/C15H21N3O4/c1-18(2)13(19)10-11-4-6-12(7-5-11)17-15(21)16-9-8-14(20)22-3/h4-7H,8-10H2,1-3H3,(H2,16,17,21) |
| InChIKey | PEMSLYKOWFPINB-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |