C16H23N5OS — CID 56794173
1-(2-cyclohexylpyrazol-3-yl)-3-[1-(1,3-thiazol-2-yl)propyl]urea (PubChem CID 56794173) has the molecular formula C16H23N5OS and a molecular weight of 333.46 g/mol. Its IUPAC name is 1-(2-cyclohexylpyrazol-3-yl)-3-[1-(1,3-thiazol-2-yl)propyl]urea.
| Compound Name | 1-(2-cyclohexylpyrazol-3-yl)-3-[1-(1,3-thiazol-2-yl)propyl]urea |
|---|---|
| PubChem CID | 56794173 |
| Molecular Formula | C16H23N5OS |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 1-(2-cyclohexylpyrazol-3-yl)-3-[1-(1,3-thiazol-2-yl)propyl]urea |
| SMILES | CCC(NC(=O)Nc1ccnn1C1CCCCC1)c1nccs1 |
| InChI | InChI=1S/C16H23N5OS/c1-2-13(15-17-10-11-23-15)19-16(22)20-14-8-9-18-21(14)12-6-4-3-5-7-12/h8-13H,2-7H2,1H3,(H2,19,20,22) |
| InChIKey | XWQOFXKXJYQBMD-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |