C10H12N4O2S — CID 97307926
1-(1,3-oxazol-2-yl)-3-[(1R)-1-(1,3-thiazol-2-yl)propyl]urea (PubChem CID 97307926) has the molecular formula C10H12N4O2S and a molecular weight of 252.30 g/mol. Its IUPAC name is 1-(1,3-oxazol-2-yl)-3-[(1R)-1-(1,3-thiazol-2-yl)propyl]urea.
| Compound Name | 1-(1,3-oxazol-2-yl)-3-[(1R)-1-(1,3-thiazol-2-yl)propyl]urea |
|---|---|
| PubChem CID | 97307926 |
| Molecular Formula | C10H12N4O2S |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 1-(1,3-oxazol-2-yl)-3-[(1R)-1-(1,3-thiazol-2-yl)propyl]urea |
| SMILES | CC[C@@H](NC(=O)Nc1ncco1)c1nccs1 |
| InChI | InChI=1S/C10H12N4O2S/c1-2-7(8-11-4-6-17-8)13-9(15)14-10-12-3-5-16-10/h3-7H,2H2,1H3,(H2,12,13,14,15)/t7-/m1/s1 |
| InChIKey | YRCCWCHMROXUSA-SSDOTTSWSA-N |
| XLogP | 2.40 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |