C15H14N4O3 — CID 56794252
(5-methyl-4-nitro-1H-pyrazol-3-yl)-spiro[2H-indole-3,1'-cyclopropane]-1-ylmethanone (PubChem CID 56794252) has the molecular formula C15H14N4O3 and a molecular weight of 298.30 g/mol. Its IUPAC name is (5-methyl-4-nitro-1H-pyrazol-3-yl)-spiro[2H-indole-3,1'-cyclopropane]-1-ylmethanone.
| Compound Name | (5-methyl-4-nitro-1H-pyrazol-3-yl)-spiro[2H-indole-3,1'-cyclopropane]-1-ylmethanone |
|---|---|
| PubChem CID | 56794252 |
| Molecular Formula | C15H14N4O3 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | (5-methyl-4-nitro-1H-pyrazol-3-yl)-spiro[2H-indole-3,1'-cyclopropane]-1-ylmethanone |
| SMILES | Cc1[nH]nc(C(=O)N2CC3(CC3)c3ccccc32)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H14N4O3/c1-9-13(19(21)22)12(17-16-9)14(20)18-8-15(6-7-15)10-4-2-3-5-11(10)18/h2-5H,6-8H2,1H3,(H,16,17) |
| InChIKey | NKYMEYIJXGXRIV-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 92.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|