C15H16ClN7O — CID 56794536
1-(2-chlorophenyl)-5-methyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]-1,2,4-triazole-3-carboxamide (PubChem CID 56794536) has the molecular formula C15H16ClN7O and a molecular weight of 345.79 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-5-methyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]-1,2,4-triazole-3-carboxamide.
| Compound Name | 1-(2-chlorophenyl)-5-methyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 56794536 |
| Molecular Formula | C15H16ClN7O |
| Molecular Weight | 345.79 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 1-(2-chlorophenyl)-5-methyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]-1,2,4-triazole-3-carboxamide |
| SMILES | Cc1nc(C(=O)NCCCc2ncn[nH]2)nn1-c1ccccc1Cl |
| InChI | InChI=1S/C15H16ClN7O/c1-10-20-14(22-23(10)12-6-3-2-5-11(12)16)15(24)17-8-4-7-13-18-9-19-21-13/h2-3,5-6,9H,4,7-8H2,1H3,(H,17,24)(H,18,19,21) |
| InChIKey | LRSMDWCREOKZBM-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.79 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|