C17H25N5O3 — CID 56794793
tert-butyl N-[3-[methyl-[(4-oxo-1,2,3-benzotriazin-3-yl)methyl]amino]propyl]carbamate (PubChem CID 56794793) has the molecular formula C17H25N5O3 and a molecular weight of 347.42 g/mol. Its IUPAC name is tert-butyl N-[3-[methyl-[(4-oxo-1,2,3-benzotriazin-3-yl)methyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[methyl-[(4-oxo-1,2,3-benzotriazin-3-yl)methyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 56794793 |
| Molecular Formula | C17H25N5O3 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | tert-butyl N-[3-[methyl-[(4-oxo-1,2,3-benzotriazin-3-yl)methyl]amino]propyl]carbamate |
| SMILES | CN(CCCNC(=O)OC(C)(C)C)Cn1nnc2ccccc2c1=O |
| InChI | InChI=1S/C17H25N5O3/c1-17(2,3)25-16(24)18-10-7-11-21(4)12-22-15(23)13-8-5-6-9-14(13)19-20-22/h5-6,8-9H,7,10-12H2,1-4H3,(H,18,24) |
| InChIKey | KCDWWKBTUREFKZ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|