C17H20N6O2 — CID 56795528
4-[[2-[2-(dimethylamino)ethylamino]-3-pyridinyl]methylamino]-3-nitrobenzonitrile (PubChem CID 56795528) has the molecular formula C17H20N6O2 and a molecular weight of 340.39 g/mol. Its IUPAC name is 4-[[2-[2-(dimethylamino)ethylamino]-3-pyridinyl]methylamino]-3-nitrobenzonitrile.
| Compound Name | 4-[[2-[2-(dimethylamino)ethylamino]-3-pyridinyl]methylamino]-3-nitrobenzonitrile |
|---|---|
| PubChem CID | 56795528 |
| Molecular Formula | C17H20N6O2 |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 4-[[2-[2-(dimethylamino)ethylamino]-3-pyridinyl]methylamino]-3-nitrobenzonitrile |
| SMILES | CN(C)CCNc1ncccc1CNc1ccc(C#N)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H20N6O2/c1-22(2)9-8-20-17-14(4-3-7-19-17)12-21-15-6-5-13(11-18)10-16(15)23(24)25/h3-7,10,21H,8-9,12H2,1-2H3,(H,19,20) |
| InChIKey | UXXYOWRDHCFMJO-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 107.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|