C14H18ClN5O3 — CID 56796265
8-[2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 56796265) has the molecular formula C14H18ClN5O3 and a molecular weight of 339.78 g/mol. Its IUPAC name is 8-[2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-[2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 56796265 |
| Molecular Formula | C14H18ClN5O3 |
| Molecular Weight | 339.78 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 8-[2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | Cc1nn(CC(=O)N2CCC3(CC2)NC(=O)NC3=O)c(C)c1Cl |
| InChI | InChI=1S/C14H18ClN5O3/c1-8-11(15)9(2)20(18-8)7-10(21)19-5-3-14(4-6-19)12(22)16-13(23)17-14/h3-7H2,1-2H3,(H2,16,17,22,23) |
| InChIKey | REXYYKKCBKOWQT-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.78 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|