C19H29N5O3 — CID 95209324
(5R)-5-ethyl-5-[1-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)acetyl]piperidin-4-yl]imidazolidine-2,4-dione (PubChem CID 95209324) has the molecular formula C19H29N5O3 and a molecular weight of 375.47 g/mol. Its IUPAC name is (5R)-5-ethyl-5-[1-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)acetyl]piperidin-4-yl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-ethyl-5-[1-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)acetyl]piperidin-4-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 95209324 |
| Molecular Formula | C19H29N5O3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | (5R)-5-ethyl-5-[1-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)acetyl]piperidin-4-yl]imidazolidine-2,4-dione |
| SMILES | CCc1c(C)nn(CC(=O)N2CCC([C@@]3(CC)NC(=O)NC3=O)CC2)c1C |
| InChI | InChI=1S/C19H29N5O3/c1-5-15-12(3)22-24(13(15)4)11-16(25)23-9-7-14(8-10-23)19(6-2)17(26)20-18(27)21-19/h14H,5-11H2,1-4H3,(H2,20,21,26,27)/t19-/m1/s1 |
| InChIKey | FMESHGLKHJRCSK-LJQANCHMSA-N |
| XLogP | 1.29 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|