C13H17NO4S2 — CID 56797127
2-(3-methylsulfonylphenoxy)-1-thiomorpholin-4-ylethanone (PubChem CID 56797127) has the molecular formula C13H17NO4S2 and a molecular weight of 315.42 g/mol. Its IUPAC name is 2-(3-methylsulfonylphenoxy)-1-thiomorpholin-4-ylethanone.
| Compound Name | 2-(3-methylsulfonylphenoxy)-1-thiomorpholin-4-ylethanone |
|---|---|
| PubChem CID | 56797127 |
| Molecular Formula | C13H17NO4S2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 2-(3-methylsulfonylphenoxy)-1-thiomorpholin-4-ylethanone |
| SMILES | CS(=O)(=O)c1cccc(OCC(=O)N2CCSCC2)c1 |
| InChI | InChI=1S/C13H17NO4S2/c1-20(16,17)12-4-2-3-11(9-12)18-10-13(15)14-5-7-19-8-6-14/h2-4,9H,5-8,10H2,1H3 |
| InChIKey | CLUPZNRQSNTMLY-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |