C19H20ClNO4S — CID 94627600
1-[(2R)-2-(2-chlorophenyl)pyrrolidin-1-yl]-2-(3-methylsulfonylphenoxy)ethanone (PubChem CID 94627600) has the molecular formula C19H20ClNO4S and a molecular weight of 393.89 g/mol. Its IUPAC name is 1-[(2R)-2-(2-chlorophenyl)pyrrolidin-1-yl]-2-(3-methylsulfonylphenoxy)ethanone.
| Compound Name | 1-[(2R)-2-(2-chlorophenyl)pyrrolidin-1-yl]-2-(3-methylsulfonylphenoxy)ethanone |
|---|---|
| PubChem CID | 94627600 |
| Molecular Formula | C19H20ClNO4S |
| Molecular Weight | 393.89 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | 1-[(2R)-2-(2-chlorophenyl)pyrrolidin-1-yl]-2-(3-methylsulfonylphenoxy)ethanone |
| SMILES | CS(=O)(=O)c1cccc(OCC(=O)N2CCC[C@@H]2c2ccccc2Cl)c1 |
| InChI | InChI=1S/C19H20ClNO4S/c1-26(23,24)15-7-4-6-14(12-15)25-13-19(22)21-11-5-10-18(21)16-8-2-3-9-17(16)20/h2-4,6-9,12,18H,5,10-11,13H2,1H3/t18-/m1/s1 |
| InChIKey | ABTJFOOHIWMYJR-GOSISDBHSA-N |
| XLogP | 3.49 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.89 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |