C16H23NO4S — CID 95591231
1-[(4S)-4-methylazepan-1-yl]-2-(3-methylsulfonylphenoxy)ethanone (PubChem CID 95591231) has the molecular formula C16H23NO4S and a molecular weight of 325.43 g/mol. Its IUPAC name is 1-[(4S)-4-methylazepan-1-yl]-2-(3-methylsulfonylphenoxy)ethanone.
| Compound Name | 1-[(4S)-4-methylazepan-1-yl]-2-(3-methylsulfonylphenoxy)ethanone |
|---|---|
| PubChem CID | 95591231 |
| Molecular Formula | C16H23NO4S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 1-[(4S)-4-methylazepan-1-yl]-2-(3-methylsulfonylphenoxy)ethanone |
| SMILES | C[C@H]1CCCN(C(=O)COc2cccc(S(C)(=O)=O)c2)CC1 |
| InChI | InChI=1S/C16H23NO4S/c1-13-5-4-9-17(10-8-13)16(18)12-21-14-6-3-7-15(11-14)22(2,19)20/h3,6-7,11,13H,4-5,8-10,12H2,1-2H3/t13-/m0/s1 |
| InChIKey | NFXLGZBOHYGYEQ-ZDUSSCGKSA-N |
| XLogP | 2.12 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |