C13H17F3N4O2 — CID 56797956
N'-(4-methoxypyrimidin-2-yl)-2-(trifluoromethyl)cyclohexane-1-carbohydrazide (PubChem CID 56797956) has the molecular formula C13H17F3N4O2 and a molecular weight of 318.30 g/mol. Its IUPAC name is N'-(4-methoxypyrimidin-2-yl)-2-(trifluoromethyl)cyclohexane-1-carbohydrazide.
| Compound Name | N'-(4-methoxypyrimidin-2-yl)-2-(trifluoromethyl)cyclohexane-1-carbohydrazide |
|---|---|
| PubChem CID | 56797956 |
| Molecular Formula | C13H17F3N4O2 |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | N'-(4-methoxypyrimidin-2-yl)-2-(trifluoromethyl)cyclohexane-1-carbohydrazide |
| SMILES | COc1ccnc(NNC(=O)C2CCCCC2C(F)(F)F)n1 |
| InChI | InChI=1S/C13H17F3N4O2/c1-22-10-6-7-17-12(18-10)20-19-11(21)8-4-2-3-5-9(8)13(14,15)16/h6-9H,2-5H2,1H3,(H,19,21)(H,17,18,20) |
| InChIKey | VEGKUPFVHQJPBM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|